C29H33ClN8O3 — CID 166630290
2-[[5-chloro-2-[4-[4-[4-(prop-2-enoylamino)butanoyl]piperazin-1-yl]anilino]pyrimidin-4-yl]amino]-N-methylbenzamide (PubChem CID 166630290) has the molecular formula C29H33ClN8O3 and a molecular weight of 577.09 g/mol. Its IUPAC name is 2-[[5-chloro-2-[4-[4-[4-(prop-2-enoylamino)butanoyl]piperazin-1-yl]anilino]pyrimidin-4-yl]amino]-N-methylbenzamide.
| Compound Name | 2-[[5-chloro-2-[4-[4-[4-(prop-2-enoylamino)butanoyl]piperazin-1-yl]anilino]pyrimidin-4-yl]amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 166630290 |
| Molecular Formula | C29H33ClN8O3 |
| Molecular Weight | 577.09 g/mol |
| Exact Mass | 576.24 |
| IUPAC Name | 2-[[5-chloro-2-[4-[4-[4-(prop-2-enoylamino)butanoyl]piperazin-1-yl]anilino]pyrimidin-4-yl]amino]-N-methylbenzamide |
| SMILES | C=CC(=O)NCCCC(=O)N1CCN(c2ccc(Nc3ncc(Cl)c(Nc4ccccc4C(=O)NC)n3)cc2)CC1 |
| InChI | InChI=1S/C29H33ClN8O3/c1-3-25(39)32-14-6-9-26(40)38-17-15-37(16-18-38)21-12-10-20(11-13-21)34-29-33-19-23(30)27(36-29)35-24-8-5-4-7-22(24)28(41)31-2/h3-5,7-8,10-13,19H,1,6,9,14-18H2,2H3,(H,31,41)(H,32,39)(H2,33,34,35,36) |
| InChIKey | DAHMGMVZHDSSPB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 131.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.09 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|