C28H29ClN8O4 — CID 176856305
2-[[5-chloro-2-[4-[[[2,3-dioxo-4-[2-(prop-2-enoylamino)ethylamino]cyclobutyl]amino]methyl]anilino]pyrimidin-4-yl]amino]-N-methylbenzamide (PubChem CID 176856305) has the molecular formula C28H29ClN8O4 and a molecular weight of 577.05 g/mol. Its IUPAC name is 2-[[5-chloro-2-[4-[[[2,3-dioxo-4-[2-(prop-2-enoylamino)ethylamino]cyclobutyl]amino]methyl]anilino]pyrimidin-4-yl]amino]-N-methylbenzamide.
| Compound Name | 2-[[5-chloro-2-[4-[[[2,3-dioxo-4-[2-(prop-2-enoylamino)ethylamino]cyclobutyl]amino]methyl]anilino]pyrimidin-4-yl]amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 176856305 |
| Molecular Formula | C28H29ClN8O4 |
| Molecular Weight | 577.05 g/mol |
| Exact Mass | 576.20 |
| IUPAC Name | 2-[[5-chloro-2-[4-[[[2,3-dioxo-4-[2-(prop-2-enoylamino)ethylamino]cyclobutyl]amino]methyl]anilino]pyrimidin-4-yl]amino]-N-methylbenzamide |
| SMILES | C=CC(=O)NCCNC1C(=O)C(=O)C1NCc1ccc(Nc2ncc(Cl)c(Nc3ccccc3C(=O)NC)n2)cc1 |
| InChI | InChI=1S/C28H29ClN8O4/c1-3-21(38)31-12-13-32-22-23(25(40)24(22)39)33-14-16-8-10-17(11-9-16)35-28-34-15-19(29)26(37-28)36-20-7-5-4-6-18(20)27(41)30-2/h3-11,15,22-23,32-33H,1,12-14H2,2H3,(H,30,41)(H,31,38)(H2,34,35,36,37) |
| InChIKey | MCASFUMSADUPOM-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 166.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.05 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|