C30H30ClN7O3 — CID 129257188
2-[[5-chloro-2-[4-[4-[(2-formylprop-2-enylamino)methyl]anilino]-2-methoxyanilino]pyrimidin-4-yl]amino]-N-methylbenzamide (PubChem CID 129257188) has the molecular formula C30H30ClN7O3 and a molecular weight of 572.07 g/mol. Its IUPAC name is 2-[[5-chloro-2-[4-[4-[(2-formylprop-2-enylamino)methyl]anilino]-2-methoxyanilino]pyrimidin-4-yl]amino]-N-methylbenzamide.
| Compound Name | 2-[[5-chloro-2-[4-[4-[(2-formylprop-2-enylamino)methyl]anilino]-2-methoxyanilino]pyrimidin-4-yl]amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 129257188 |
| Molecular Formula | C30H30ClN7O3 |
| Molecular Weight | 572.07 g/mol |
| Exact Mass | 571.21 |
| IUPAC Name | 2-[[5-chloro-2-[4-[4-[(2-formylprop-2-enylamino)methyl]anilino]-2-methoxyanilino]pyrimidin-4-yl]amino]-N-methylbenzamide |
| SMILES | C=C(C=O)CNCc1ccc(Nc2ccc(Nc3ncc(Cl)c(Nc4ccccc4C(=O)NC)n3)c(OC)c2)cc1 |
| InChI | InChI=1S/C30H30ClN7O3/c1-19(18-39)15-33-16-20-8-10-21(11-9-20)35-22-12-13-26(27(14-22)41-3)37-30-34-17-24(31)28(38-30)36-25-7-5-4-6-23(25)29(40)32-2/h4-14,17-18,33,35H,1,15-16H2,2-3H3,(H,32,40)(H2,34,36,37,38) |
| InChIKey | FTVWJKPYYXQJPS-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 129.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.07 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|