C35H48ClN7O3 — CID 163507901
2-[[5-chloro-2-[2-methoxy-4-[4-(10-oxododecyl)piperazin-1-yl]anilino]pyrimidin-4-yl]amino]-N-methylbenzamide (PubChem CID 163507901) has the molecular formula C35H48ClN7O3 and a molecular weight of 650.27 g/mol. Its IUPAC name is 2-[[5-chloro-2-[2-methoxy-4-[4-(10-oxododecyl)piperazin-1-yl]anilino]pyrimidin-4-yl]amino]-N-methylbenzamide.
| Compound Name | 2-[[5-chloro-2-[2-methoxy-4-[4-(10-oxododecyl)piperazin-1-yl]anilino]pyrimidin-4-yl]amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 163507901 |
| Molecular Formula | C35H48ClN7O3 |
| Molecular Weight | 650.27 g/mol |
| Exact Mass | 649.35 |
| IUPAC Name | 2-[[5-chloro-2-[2-methoxy-4-[4-(10-oxododecyl)piperazin-1-yl]anilino]pyrimidin-4-yl]amino]-N-methylbenzamide |
| SMILES | CCC(=O)CCCCCCCCCN1CCN(c2ccc(Nc3ncc(Cl)c(Nc4ccccc4C(=O)NC)n3)c(OC)c2)CC1 |
| InChI | InChI=1S/C35H48ClN7O3/c1-4-27(44)14-10-8-6-5-7-9-13-19-42-20-22-43(23-21-42)26-17-18-31(32(24-26)46-3)40-35-38-25-29(36)33(41-35)39-30-16-12-11-15-28(30)34(45)37-2/h11-12,15-18,24-25H,4-10,13-14,19-23H2,1-3H3,(H,37,45)(H2,38,39,40,41) |
| InChIKey | VSXXLFRLPVAHPR-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 111.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.27 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|