C27H34ClN7O4S — CID 175455977
[2-[[2-[4-[4-(4-carboxybutyl)piperazin-1-yl]-2-methoxyanilino]-5-chloropyrimidin-4-yl]amino]anilino]-methyl-oxidosulfanium (PubChem CID 175455977) has the molecular formula C27H34ClN7O4S and a molecular weight of 588.13 g/mol. Its IUPAC name is [2-[[2-[4-[4-(4-carboxybutyl)piperazin-1-yl]-2-methoxyanilino]-5-chloropyrimidin-4-yl]amino]anilino]-methyl-oxidosulfanium.
| Compound Name | [2-[[2-[4-[4-(4-carboxybutyl)piperazin-1-yl]-2-methoxyanilino]-5-chloropyrimidin-4-yl]amino]anilino]-methyl-oxidosulfanium |
|---|---|
| PubChem CID | 175455977 |
| Molecular Formula | C27H34ClN7O4S |
| Molecular Weight | 588.13 g/mol |
| Exact Mass | 587.21 |
| IUPAC Name | [2-[[2-[4-[4-(4-carboxybutyl)piperazin-1-yl]-2-methoxyanilino]-5-chloropyrimidin-4-yl]amino]anilino]-methyl-oxidosulfanium |
| SMILES | COc1cc(N2CCN(CCCCC(=O)O)CC2)ccc1Nc1ncc(Cl)c(Nc2ccccc2N[S+](C)[O-])n1 |
| InChI | InChI=1S/C27H34ClN7O4S/c1-39-24-17-19(35-15-13-34(14-16-35)12-6-5-9-25(36)37)10-11-23(24)31-27-29-18-20(28)26(32-27)30-21-7-3-4-8-22(21)33-40(2)38/h3-4,7-8,10-11,17-18,33H,5-6,9,12-16H2,1-2H3,(H,36,37)(H2,29,30,31,32) |
| InChIKey | CNSSIASIILCXSN-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 137.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.13 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|