C33H44ClN7O3 — CID 163507898
2-[[5-chloro-2-[2-methoxy-4-[4-(8-oxodecyl)piperazin-1-yl]anilino]pyrimidin-4-yl]amino]-N-methylbenzamide (PubChem CID 163507898) has the molecular formula C33H44ClN7O3 and a molecular weight of 622.21 g/mol. Its IUPAC name is 2-[[5-chloro-2-[2-methoxy-4-[4-(8-oxodecyl)piperazin-1-yl]anilino]pyrimidin-4-yl]amino]-N-methylbenzamide.
| Compound Name | 2-[[5-chloro-2-[2-methoxy-4-[4-(8-oxodecyl)piperazin-1-yl]anilino]pyrimidin-4-yl]amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 163507898 |
| Molecular Formula | C33H44ClN7O3 |
| Molecular Weight | 622.21 g/mol |
| Exact Mass | 621.32 |
| IUPAC Name | 2-[[5-chloro-2-[2-methoxy-4-[4-(8-oxodecyl)piperazin-1-yl]anilino]pyrimidin-4-yl]amino]-N-methylbenzamide |
| SMILES | CCC(=O)CCCCCCCN1CCN(c2ccc(Nc3ncc(Cl)c(Nc4ccccc4C(=O)NC)n3)c(OC)c2)CC1 |
| InChI | InChI=1S/C33H44ClN7O3/c1-4-25(42)12-8-6-5-7-11-17-40-18-20-41(21-19-40)24-15-16-29(30(22-24)44-3)38-33-36-23-27(34)31(39-33)37-28-14-10-9-13-26(28)32(43)35-2/h9-10,13-16,22-23H,4-8,11-12,17-21H2,1-3H3,(H,35,43)(H2,36,37,38,39) |
| InChIKey | ULUMGQXIMFATBN-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 111.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.21 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|