C30H34ClN7O3 — CID 166630924
2-[[5-chloro-2-[4-[1-[4-(prop-2-enoylamino)butanoyl]piperidin-4-yl]anilino]pyrimidin-4-yl]amino]-N-methylbenzamide (PubChem CID 166630924) has the molecular formula C30H34ClN7O3 and a molecular weight of 576.10 g/mol. Its IUPAC name is 2-[[5-chloro-2-[4-[1-[4-(prop-2-enoylamino)butanoyl]piperidin-4-yl]anilino]pyrimidin-4-yl]amino]-N-methylbenzamide.
| Compound Name | 2-[[5-chloro-2-[4-[1-[4-(prop-2-enoylamino)butanoyl]piperidin-4-yl]anilino]pyrimidin-4-yl]amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 166630924 |
| Molecular Formula | C30H34ClN7O3 |
| Molecular Weight | 576.10 g/mol |
| Exact Mass | 575.24 |
| IUPAC Name | 2-[[5-chloro-2-[4-[1-[4-(prop-2-enoylamino)butanoyl]piperidin-4-yl]anilino]pyrimidin-4-yl]amino]-N-methylbenzamide |
| SMILES | C=CC(=O)NCCCC(=O)N1CCC(c2ccc(Nc3ncc(Cl)c(Nc4ccccc4C(=O)NC)n3)cc2)CC1 |
| InChI | InChI=1S/C30H34ClN7O3/c1-3-26(39)33-16-6-9-27(40)38-17-14-21(15-18-38)20-10-12-22(13-11-20)35-30-34-19-24(31)28(37-30)36-25-8-5-4-7-23(25)29(41)32-2/h3-5,7-8,10-13,19,21H,1,6,9,14-18H2,2H3,(H,32,41)(H,33,39)(H2,34,35,36,37) |
| InChIKey | NVGBYJLJZJMQTG-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 128.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.10 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|