C18H27N3O4 — CID 42897624
ethyl N-[3-methyl-1-(4-morpholin-4-ylanilino)-1-oxobutan-2-yl]carbamate (PubChem CID 42897624) has the molecular formula C18H27N3O4 and a molecular weight of 349.43 g/mol. Its IUPAC name is ethyl N-[3-methyl-1-(4-morpholin-4-ylanilino)-1-oxobutan-2-yl]carbamate.
| Compound Name | ethyl N-[3-methyl-1-(4-morpholin-4-ylanilino)-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 42897624 |
| Molecular Formula | C18H27N3O4 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | ethyl N-[3-methyl-1-(4-morpholin-4-ylanilino)-1-oxobutan-2-yl]carbamate |
| SMILES | CCOC(=O)NC(C(=O)Nc1ccc(N2CCOCC2)cc1)C(C)C |
| InChI | InChI=1S/C18H27N3O4/c1-4-25-18(23)20-16(13(2)3)17(22)19-14-5-7-15(8-6-14)21-9-11-24-12-10-21/h5-8,13,16H,4,9-12H2,1-3H3,(H,19,22)(H,20,23) |
| InChIKey | CHIVCJCHULEPEL-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|