C19H25N3O5 — CID 46431121
ethyl N-[1-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]anilino]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 46431121) has the molecular formula C19H25N3O5 and a molecular weight of 375.43 g/mol. Its IUPAC name is ethyl N-[1-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]anilino]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | ethyl N-[1-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]anilino]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 46431121 |
| Molecular Formula | C19H25N3O5 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | ethyl N-[1-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]anilino]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | CCOC(=O)NC(C(=O)Nc1ccc(CN2C(=O)CCC2=O)cc1)C(C)C |
| InChI | InChI=1S/C19H25N3O5/c1-4-27-19(26)21-17(12(2)3)18(25)20-14-7-5-13(6-8-14)11-22-15(23)9-10-16(22)24/h5-8,12,17H,4,9-11H2,1-3H3,(H,20,25)(H,21,26) |
| InChIKey | JVPJTNJSLBGONX-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|