C16H22ClN3O3S — CID 119284992
(2S)-2-amino-N-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-4-methylsulfanylbutanamide;hydrochloride (PubChem CID 119284992) has the molecular formula C16H22ClN3O3S and a molecular weight of 371.89 g/mol. Its IUPAC name is (2S)-2-amino-N-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-4-methylsulfanylbutanamide;hydrochloride.
| Compound Name | (2S)-2-amino-N-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-4-methylsulfanylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119284992 |
| Molecular Formula | C16H22ClN3O3S |
| Molecular Weight | 371.89 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | (2S)-2-amino-N-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-4-methylsulfanylbutanamide;hydrochloride |
| SMILES | CSCC[C@H](N)C(=O)Nc1ccc(CN2C(=O)CCC2=O)cc1.Cl |
| InChI | InChI=1S/C16H21N3O3S.ClH/c1-23-9-8-13(17)16(22)18-12-4-2-11(3-5-12)10-19-14(20)6-7-15(19)21;/h2-5,13H,6-10,17H2,1H3,(H,18,22);1H/t13-;/m0./s1 |
| InChIKey | NVURENVNXXMPGE-ZOWNYOTGSA-N |
| XLogP | 1.78 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.89 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|