C23H26N2O3 — CID 51933857
(2S,3S)-N-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-3-methyl-2-phenylpentanamide (PubChem CID 51933857) has the molecular formula C23H26N2O3 and a molecular weight of 378.47 g/mol. Its IUPAC name is (2S,3S)-N-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-3-methyl-2-phenylpentanamide.
| Compound Name | (2S,3S)-N-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-3-methyl-2-phenylpentanamide |
|---|---|
| PubChem CID | 51933857 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | (2S,3S)-N-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]-3-methyl-2-phenylpentanamide |
| SMILES | CC[C@H](C)[C@H](C(=O)Nc1ccc(CN2C(=O)CCC2=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C23H26N2O3/c1-3-16(2)22(18-7-5-4-6-8-18)23(28)24-19-11-9-17(10-12-19)15-25-20(26)13-14-21(25)27/h4-12,16,22H,3,13-15H2,1-2H3,(H,24,28)/t16-,22-/m0/s1 |
| InChIKey | MROWKXRNYALGBN-AOMKIAJQSA-N |
| XLogP | 4.10 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|