C21H24ClN3O3 — CID 78836405
N-[1-(4-chlorophenyl)ethyl]-2-[(E)-(4-morpholin-4-ylphenyl)methylideneamino]oxyacetamide (PubChem CID 78836405) has the molecular formula C21H24ClN3O3 and a molecular weight of 401.89 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)ethyl]-2-[(E)-(4-morpholin-4-ylphenyl)methylideneamino]oxyacetamide.
| Compound Name | N-[1-(4-chlorophenyl)ethyl]-2-[(E)-(4-morpholin-4-ylphenyl)methylideneamino]oxyacetamide |
|---|---|
| PubChem CID | 78836405 |
| Molecular Formula | C21H24ClN3O3 |
| Molecular Weight | 401.89 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | N-[1-(4-chlorophenyl)ethyl]-2-[(E)-(4-morpholin-4-ylphenyl)methylideneamino]oxyacetamide |
| SMILES | CC(NC(=O)CO/N=C/c1ccc(N2CCOCC2)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H24ClN3O3/c1-16(18-4-6-19(22)7-5-18)24-21(26)15-28-23-14-17-2-8-20(9-3-17)25-10-12-27-13-11-25/h2-9,14,16H,10-13,15H2,1H3,(H,24,26)/b23-14+ |
| InChIKey | GGRKSBLZYAIVLQ-OEAKJJBVSA-N |
| XLogP | 3.40 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.89 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|