C21H22N2O6 — CID 24606431
methyl 4-[(E)-[2-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylamino]-2-oxoethoxy]iminomethyl]benzoate (PubChem CID 24606431) has the molecular formula C21H22N2O6 and a molecular weight of 398.42 g/mol. Its IUPAC name is methyl 4-[(E)-[2-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylamino]-2-oxoethoxy]iminomethyl]benzoate.
| Compound Name | methyl 4-[(E)-[2-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylamino]-2-oxoethoxy]iminomethyl]benzoate |
|---|---|
| PubChem CID | 24606431 |
| Molecular Formula | C21H22N2O6 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | methyl 4-[(E)-[2-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylamino]-2-oxoethoxy]iminomethyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=N/OCC(=O)NC(C)c2ccc3c(c2)OCCO3)cc1 |
| InChI | InChI=1S/C21H22N2O6/c1-14(17-7-8-18-19(11-17)28-10-9-27-18)23-20(24)13-29-22-12-15-3-5-16(6-4-15)21(25)26-2/h3-8,11-12,14H,9-10,13H2,1-2H3,(H,23,24)/b22-12+ |
| InChIKey | SYONCPZUYXYQQS-WSDLNYQXSA-N |
| XLogP | 2.47 |
| TPSA | 95.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|