C19H18N2O6 — CID 2084780
methyl 4-[[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethoxy]iminomethyl]benzoate (PubChem CID 2084780) has the molecular formula C19H18N2O6 and a molecular weight of 370.36 g/mol. Its IUPAC name is methyl 4-[[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethoxy]iminomethyl]benzoate.
| Compound Name | methyl 4-[[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethoxy]iminomethyl]benzoate |
|---|---|
| PubChem CID | 2084780 |
| Molecular Formula | C19H18N2O6 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | methyl 4-[[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethoxy]iminomethyl]benzoate |
| SMILES | COC(=O)c1ccc(C=NOCC(=O)Nc2ccc3c(c2)OCCO3)cc1 |
| InChI | InChI=1S/C19H18N2O6/c1-24-19(23)14-4-2-13(3-5-14)11-20-27-12-18(22)21-15-6-7-16-17(10-15)26-9-8-25-16/h2-7,10-11H,8-9,12H2,1H3,(H,21,22) |
| InChIKey | CCKSUZWPKNXMTK-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 95.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|