C19H19NO5S — CID 18280910
[2-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylamino]-2-oxoethyl] (E)-3-thiophen-3-ylprop-2-enoate (PubChem CID 18280910) has the molecular formula C19H19NO5S and a molecular weight of 373.43 g/mol. Its IUPAC name is [2-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylamino]-2-oxoethyl] (E)-3-thiophen-3-ylprop-2-enoate.
| Compound Name | [2-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylamino]-2-oxoethyl] (E)-3-thiophen-3-ylprop-2-enoate |
|---|---|
| PubChem CID | 18280910 |
| Molecular Formula | C19H19NO5S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | [2-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethylamino]-2-oxoethyl] (E)-3-thiophen-3-ylprop-2-enoate |
| SMILES | CC(NC(=O)COC(=O)/C=C/c1ccsc1)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C19H19NO5S/c1-13(15-3-4-16-17(10-15)24-8-7-23-16)20-18(21)11-25-19(22)5-2-14-6-9-26-12-14/h2-6,9-10,12-13H,7-8,11H2,1H3,(H,20,21)/b5-2+ |
| InChIKey | UXZDPQKZMIMXQR-GORDUTHDSA-N |
| XLogP | 2.95 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|