C32H36F3N5O2 — CID 70256832
(E)-N-(2-aminophenyl)-3-[4-[2-[4-(1,1-difluoroethyl)-3-fluoroanilino]-2-oxo-1-(2-piperidin-1-ylethylamino)ethyl]phenyl]prop-2-enamide (PubChem CID 70256832) has the molecular formula C32H36F3N5O2 and a molecular weight of 579.67 g/mol. Its IUPAC name is (E)-N-(2-aminophenyl)-3-[4-[2-[4-(1,1-difluoroethyl)-3-fluoroanilino]-2-oxo-1-(2-piperidin-1-ylethylamino)ethyl]phenyl]prop-2-enamide.
| Compound Name | (E)-N-(2-aminophenyl)-3-[4-[2-[4-(1,1-difluoroethyl)-3-fluoroanilino]-2-oxo-1-(2-piperidin-1-ylethylamino)ethyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 70256832 |
| Molecular Formula | C32H36F3N5O2 |
| Molecular Weight | 579.67 g/mol |
| Exact Mass | 579.28 |
| IUPAC Name | (E)-N-(2-aminophenyl)-3-[4-[2-[4-(1,1-difluoroethyl)-3-fluoroanilino]-2-oxo-1-(2-piperidin-1-ylethylamino)ethyl]phenyl]prop-2-enamide |
| SMILES | CC(F)(F)c1ccc(NC(=O)C(NCCN2CCCCC2)c2ccc(/C=C/C(=O)Nc3ccccc3N)cc2)cc1F |
| InChI | InChI=1S/C32H36F3N5O2/c1-32(34,35)25-15-14-24(21-26(25)33)38-31(42)30(37-17-20-40-18-5-2-6-19-40)23-12-9-22(10-13-23)11-16-29(41)39-28-8-4-3-7-27(28)36/h3-4,7-16,21,30,37H,2,5-6,17-20,36H2,1H3,(H,38,42)(H,39,41)/b16-11+ |
| InChIKey | ABJJDBZKSHSJSI-LFIBNONCSA-N |
| XLogP | 5.93 |
| TPSA | 99.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.67 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|