C32H34F3N5O2S — CID 162586417
(E)-N-(2-aminophenyl)-3-[4-[2-[4-(1,1-difluoroprop-2-enyl)-2-fluoroanilino]-2-oxo-1-(2-thiomorpholin-4-ylethylamino)ethyl]phenyl]prop-2-enamide (PubChem CID 162586417) has the molecular formula C32H34F3N5O2S and a molecular weight of 609.72 g/mol. Its IUPAC name is (E)-N-(2-aminophenyl)-3-[4-[2-[4-(1,1-difluoroprop-2-enyl)-2-fluoroanilino]-2-oxo-1-(2-thiomorpholin-4-ylethylamino)ethyl]phenyl]prop-2-enamide.
| Compound Name | (E)-N-(2-aminophenyl)-3-[4-[2-[4-(1,1-difluoroprop-2-enyl)-2-fluoroanilino]-2-oxo-1-(2-thiomorpholin-4-ylethylamino)ethyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 162586417 |
| Molecular Formula | C32H34F3N5O2S |
| Molecular Weight | 609.72 g/mol |
| Exact Mass | 609.24 |
| IUPAC Name | (E)-N-(2-aminophenyl)-3-[4-[2-[4-(1,1-difluoroprop-2-enyl)-2-fluoroanilino]-2-oxo-1-(2-thiomorpholin-4-ylethylamino)ethyl]phenyl]prop-2-enamide |
| SMILES | C=CC(F)(F)c1ccc(NC(=O)C(NCCN2CCSCC2)c2ccc(/C=C/C(=O)Nc3ccccc3N)cc2)c(F)c1 |
| InChI | InChI=1S/C32H34F3N5O2S/c1-2-32(34,35)24-12-13-27(25(33)21-24)39-31(42)30(37-15-16-40-17-19-43-20-18-40)23-10-7-22(8-11-23)9-14-29(41)38-28-6-4-3-5-26(28)36/h2-14,21,30,37H,1,15-20,36H2,(H,38,41)(H,39,42)/b14-9+ |
| InChIKey | YITLQIYROPLUGJ-NTEUORMPSA-N |
| XLogP | 5.66 |
| TPSA | 99.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.72 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|