C39H43N5O2 — CID 53326925
(E)-N-(2-aminophenyl)-3-[4-[2-[4-(4-cyclopropylphenyl)anilino]-2-oxo-1-(2-piperidin-1-ylethylamino)ethyl]phenyl]prop-2-enamide (PubChem CID 53326925) has the molecular formula C39H43N5O2 and a molecular weight of 613.81 g/mol. Its IUPAC name is (E)-N-(2-aminophenyl)-3-[4-[2-[4-(4-cyclopropylphenyl)anilino]-2-oxo-1-(2-piperidin-1-ylethylamino)ethyl]phenyl]prop-2-enamide.
| Compound Name | (E)-N-(2-aminophenyl)-3-[4-[2-[4-(4-cyclopropylphenyl)anilino]-2-oxo-1-(2-piperidin-1-ylethylamino)ethyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 53326925 |
| Molecular Formula | C39H43N5O2 |
| Molecular Weight | 613.81 g/mol |
| Exact Mass | 613.34 |
| IUPAC Name | (E)-N-(2-aminophenyl)-3-[4-[2-[4-(4-cyclopropylphenyl)anilino]-2-oxo-1-(2-piperidin-1-ylethylamino)ethyl]phenyl]prop-2-enamide |
| SMILES | Nc1ccccc1NC(=O)/C=C/c1ccc(C(NCCN2CCCCC2)C(=O)Nc2ccc(-c3ccc(C4CC4)cc3)cc2)cc1 |
| InChI | InChI=1S/C39H43N5O2/c40-35-6-2-3-7-36(35)43-37(45)23-10-28-8-11-33(12-9-28)38(41-24-27-44-25-4-1-5-26-44)39(46)42-34-21-19-32(20-22-34)31-17-15-30(16-18-31)29-13-14-29/h2-3,6-12,15-23,29,38,41H,1,4-5,13-14,24-27,40H2,(H,42,46)(H,43,45)/b23-10+ |
| InChIKey | XWIGQKXPVMJLRO-AUEPDCJTSA-N |
| XLogP | 7.22 |
| TPSA | 99.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.81 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|