C34H38N4O3 — CID 59238317
2-[4-[(E)-3-(2-aminoanilino)-3-oxoprop-1-enyl]phenyl]-N-(4-cyclopropylphenyl)-5-[(1R,4R)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]pentanamide (PubChem CID 59238317) has the molecular formula C34H38N4O3 and a molecular weight of 550.70 g/mol. Its IUPAC name is 2-[4-[(E)-3-(2-aminoanilino)-3-oxoprop-1-enyl]phenyl]-N-(4-cyclopropylphenyl)-5-[(1R,4R)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]pentanamide.
| Compound Name | 2-[4-[(E)-3-(2-aminoanilino)-3-oxoprop-1-enyl]phenyl]-N-(4-cyclopropylphenyl)-5-[(1R,4R)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]pentanamide |
|---|---|
| PubChem CID | 59238317 |
| Molecular Formula | C34H38N4O3 |
| Molecular Weight | 550.70 g/mol |
| Exact Mass | 550.29 |
| IUPAC Name | 2-[4-[(E)-3-(2-aminoanilino)-3-oxoprop-1-enyl]phenyl]-N-(4-cyclopropylphenyl)-5-[(1R,4R)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]pentanamide |
| SMILES | Nc1ccccc1NC(=O)/C=C/c1ccc(C(CCCN2C[C@H]3C[C@@H]2CO3)C(=O)Nc2ccc(C3CC3)cc2)cc1 |
| InChI | InChI=1S/C34H38N4O3/c35-31-5-1-2-6-32(31)37-33(39)18-9-23-7-10-26(11-8-23)30(4-3-19-38-21-29-20-28(38)22-41-29)34(40)36-27-16-14-25(15-17-27)24-12-13-24/h1-2,5-11,14-18,24,28-30H,3-4,12-13,19-22,35H2,(H,36,40)(H,37,39)/b18-9+/t28-,29-,30?/m1/s1 |
| InChIKey | QGSMSBDBJQLEJE-OTOXFXBHSA-N |
| XLogP | 5.77 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.70 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|