C31H33ClN4O3 — CID 67230760
2-[4-[(E)-3-(2-aminoanilino)-3-oxoprop-1-enyl]phenyl]-N-(4-chlorophenyl)-5-(2-oxa-5-azabicyclo[2.2.1]heptan-5-yl)pentanamide (PubChem CID 67230760) has the molecular formula C31H33ClN4O3 and a molecular weight of 545.08 g/mol. Its IUPAC name is 2-[4-[(E)-3-(2-aminoanilino)-3-oxoprop-1-enyl]phenyl]-N-(4-chlorophenyl)-5-(2-oxa-5-azabicyclo[2.2.1]heptan-5-yl)pentanamide.
| Compound Name | 2-[4-[(E)-3-(2-aminoanilino)-3-oxoprop-1-enyl]phenyl]-N-(4-chlorophenyl)-5-(2-oxa-5-azabicyclo[2.2.1]heptan-5-yl)pentanamide |
|---|---|
| PubChem CID | 67230760 |
| Molecular Formula | C31H33ClN4O3 |
| Molecular Weight | 545.08 g/mol |
| Exact Mass | 544.22 |
| IUPAC Name | 2-[4-[(E)-3-(2-aminoanilino)-3-oxoprop-1-enyl]phenyl]-N-(4-chlorophenyl)-5-(2-oxa-5-azabicyclo[2.2.1]heptan-5-yl)pentanamide |
| SMILES | Nc1ccccc1NC(=O)/C=C/c1ccc(C(CCCN2CC3CC2CO3)C(=O)Nc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C31H33ClN4O3/c32-23-12-14-24(15-13-23)34-31(38)27(4-3-17-36-19-26-18-25(36)20-39-26)22-10-7-21(8-11-22)9-16-30(37)35-29-6-2-1-5-28(29)33/h1-2,5-16,25-27H,3-4,17-20,33H2,(H,34,38)(H,35,37)/b16-9+ |
| InChIKey | AKIJPBSIEWFPTE-CXUHLZMHSA-N |
| XLogP | 5.55 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.08 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|