C32H38ClN5O2 — CID 67231004
3-[4-[(E)-3-(2-aminoanilino)-3-oxoprop-1-enyl]phenyl]-N-(4-chlorophenyl)-2-[3-(diethylamino)pyrrolidin-1-yl]propanamide (PubChem CID 67231004) has the molecular formula C32H38ClN5O2 and a molecular weight of 560.14 g/mol. Its IUPAC name is 3-[4-[(E)-3-(2-aminoanilino)-3-oxoprop-1-enyl]phenyl]-N-(4-chlorophenyl)-2-[3-(diethylamino)pyrrolidin-1-yl]propanamide.
| Compound Name | 3-[4-[(E)-3-(2-aminoanilino)-3-oxoprop-1-enyl]phenyl]-N-(4-chlorophenyl)-2-[3-(diethylamino)pyrrolidin-1-yl]propanamide |
|---|---|
| PubChem CID | 67231004 |
| Molecular Formula | C32H38ClN5O2 |
| Molecular Weight | 560.14 g/mol |
| Exact Mass | 559.27 |
| IUPAC Name | 3-[4-[(E)-3-(2-aminoanilino)-3-oxoprop-1-enyl]phenyl]-N-(4-chlorophenyl)-2-[3-(diethylamino)pyrrolidin-1-yl]propanamide |
| SMILES | CCN(CC)C1CCN(C(Cc2ccc(/C=C/C(=O)Nc3ccccc3N)cc2)C(=O)Nc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C32H38ClN5O2/c1-3-37(4-2)27-19-20-38(22-27)30(32(40)35-26-16-14-25(33)15-17-26)21-24-11-9-23(10-12-24)13-18-31(39)36-29-8-6-5-7-28(29)34/h5-18,27,30H,3-4,19-22,34H2,1-2H3,(H,35,40)(H,36,39)/b18-13+ |
| InChIKey | CDRCFTZUZUKZOT-QGOAFFKASA-N |
| XLogP | 5.54 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.14 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|