C32H34BrN3O3 — CID 159234231
2-[4-[(E)-4-(2-aminophenyl)-3-oxobut-1-enyl]phenyl]-N-(4-bromophenyl)-5-[(1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]pentanamide (PubChem CID 159234231) has the molecular formula C32H34BrN3O3 and a molecular weight of 588.55 g/mol. Its IUPAC name is 2-[4-[(E)-4-(2-aminophenyl)-3-oxobut-1-enyl]phenyl]-N-(4-bromophenyl)-5-[(1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]pentanamide.
| Compound Name | 2-[4-[(E)-4-(2-aminophenyl)-3-oxobut-1-enyl]phenyl]-N-(4-bromophenyl)-5-[(1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]pentanamide |
|---|---|
| PubChem CID | 159234231 |
| Molecular Formula | C32H34BrN3O3 |
| Molecular Weight | 588.55 g/mol |
| Exact Mass | 587.18 |
| IUPAC Name | 2-[4-[(E)-4-(2-aminophenyl)-3-oxobut-1-enyl]phenyl]-N-(4-bromophenyl)-5-[(1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]pentanamide |
| SMILES | Nc1ccccc1CC(=O)/C=C/c1ccc(C(CCCN2C[C@@H]3C[C@H]2CO3)C(=O)Nc2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C32H34BrN3O3/c33-25-12-14-26(15-13-25)35-32(38)30(5-3-17-36-20-29-19-27(36)21-39-29)23-10-7-22(8-11-23)9-16-28(37)18-24-4-1-2-6-31(24)34/h1-2,4,6-16,27,29-30H,3,5,17-21,34H2,(H,35,38)/b16-9+/t27-,29-,30?/m0/s1 |
| InChIKey | KTGSELOEWTZTJM-ZTCRLZGMSA-N |
| XLogP | 5.83 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.55 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|