C31H37N5O2 — CID 68507948
N-(2-aminophenyl)-3-[4-[2-(benzylamino)-1-[2-(1-methylpyrrolidin-2-yl)ethylamino]-2-oxoethyl]phenyl]prop-2-enamide (PubChem CID 68507948) has the molecular formula C31H37N5O2 and a molecular weight of 511.67 g/mol. Its IUPAC name is N-(2-aminophenyl)-3-[4-[2-(benzylamino)-1-[2-(1-methylpyrrolidin-2-yl)ethylamino]-2-oxoethyl]phenyl]prop-2-enamide.
| Compound Name | N-(2-aminophenyl)-3-[4-[2-(benzylamino)-1-[2-(1-methylpyrrolidin-2-yl)ethylamino]-2-oxoethyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 68507948 |
| Molecular Formula | C31H37N5O2 |
| Molecular Weight | 511.67 g/mol |
| Exact Mass | 511.29 |
| IUPAC Name | N-(2-aminophenyl)-3-[4-[2-(benzylamino)-1-[2-(1-methylpyrrolidin-2-yl)ethylamino]-2-oxoethyl]phenyl]prop-2-enamide |
| SMILES | CN1CCCC1CCNC(C(=O)NCc1ccccc1)c1ccc(C=CC(=O)Nc2ccccc2N)cc1 |
| InChI | InChI=1S/C31H37N5O2/c1-36-21-7-10-26(36)19-20-33-30(31(38)34-22-24-8-3-2-4-9-24)25-16-13-23(14-17-25)15-18-29(37)35-28-12-6-5-11-27(28)32/h2-6,8-9,11-18,26,30,33H,7,10,19-22,32H2,1H3,(H,34,38)(H,35,37) |
| InChIKey | BVYYQNLJGFSEOS-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 99.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.67 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|