C31H34F3N5O2S — CID 70256831
(E)-N-(2-aminophenyl)-3-[4-[2-[4-(1,1-difluoroethyl)-2-fluoroanilino]-2-oxo-1-(2-thiomorpholin-4-ylethylamino)ethyl]phenyl]prop-2-enamide (PubChem CID 70256831) has the molecular formula C31H34F3N5O2S and a molecular weight of 597.71 g/mol. Its IUPAC name is (E)-N-(2-aminophenyl)-3-[4-[2-[4-(1,1-difluoroethyl)-2-fluoroanilino]-2-oxo-1-(2-thiomorpholin-4-ylethylamino)ethyl]phenyl]prop-2-enamide.
| Compound Name | (E)-N-(2-aminophenyl)-3-[4-[2-[4-(1,1-difluoroethyl)-2-fluoroanilino]-2-oxo-1-(2-thiomorpholin-4-ylethylamino)ethyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 70256831 |
| Molecular Formula | C31H34F3N5O2S |
| Molecular Weight | 597.71 g/mol |
| Exact Mass | 597.24 |
| IUPAC Name | (E)-N-(2-aminophenyl)-3-[4-[2-[4-(1,1-difluoroethyl)-2-fluoroanilino]-2-oxo-1-(2-thiomorpholin-4-ylethylamino)ethyl]phenyl]prop-2-enamide |
| SMILES | CC(F)(F)c1ccc(NC(=O)C(NCCN2CCSCC2)c2ccc(/C=C/C(=O)Nc3ccccc3N)cc2)c(F)c1 |
| InChI | InChI=1S/C31H34F3N5O2S/c1-31(33,34)23-11-12-26(24(32)20-23)38-30(41)29(36-14-15-39-16-18-42-19-17-39)22-9-6-21(7-10-22)8-13-28(40)37-27-5-3-2-4-25(27)35/h2-13,20,29,36H,14-19,35H2,1H3,(H,37,40)(H,38,41)/b13-8+ |
| InChIKey | PTJHWYGHNQSDOL-MDWZMJQESA-N |
| XLogP | 5.49 |
| TPSA | 99.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.71 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|