C29H22F3N3O2 — CID 151753400
2-[4-[(E)-3-(2-aminoanilino)-3-oxoprop-1-enyl]phenyl]-6-[4-(trifluoromethyl)phenyl]benzamide (PubChem CID 151753400) has the molecular formula C29H22F3N3O2 and a molecular weight of 501.51 g/mol. Its IUPAC name is 2-[4-[(E)-3-(2-aminoanilino)-3-oxoprop-1-enyl]phenyl]-6-[4-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 2-[4-[(E)-3-(2-aminoanilino)-3-oxoprop-1-enyl]phenyl]-6-[4-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 151753400 |
| Molecular Formula | C29H22F3N3O2 |
| Molecular Weight | 501.51 g/mol |
| Exact Mass | 501.17 |
| IUPAC Name | 2-[4-[(E)-3-(2-aminoanilino)-3-oxoprop-1-enyl]phenyl]-6-[4-(trifluoromethyl)phenyl]benzamide |
| SMILES | NC(=O)c1c(-c2ccc(/C=C/C(=O)Nc3ccccc3N)cc2)cccc1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C29H22F3N3O2/c30-29(31,32)21-15-13-20(14-16-21)23-5-3-4-22(27(23)28(34)37)19-11-8-18(9-12-19)10-17-26(36)35-25-7-2-1-6-24(25)33/h1-17H,33H2,(H2,34,37)(H,35,36)/b17-10+ |
| InChIKey | RPAOWNFEFVXUHP-LICLKQGHSA-N |
| XLogP | 6.37 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.51 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|