C27H27ClN4O2 — CID 71460843
(3R,4S)-4-[4-[(E)-3-(2-aminoanilino)-3-oxoprop-1-enyl]phenyl]-N-(3-chlorophenyl)-1-methylpyrrolidine-3-carboxamide (PubChem CID 71460843) has the molecular formula C27H27ClN4O2 and a molecular weight of 474.99 g/mol. Its IUPAC name is (3R,4S)-4-[4-[(E)-3-(2-aminoanilino)-3-oxoprop-1-enyl]phenyl]-N-(3-chlorophenyl)-1-methylpyrrolidine-3-carboxamide.
| Compound Name | (3R,4S)-4-[4-[(E)-3-(2-aminoanilino)-3-oxoprop-1-enyl]phenyl]-N-(3-chlorophenyl)-1-methylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 71460843 |
| Molecular Formula | C27H27ClN4O2 |
| Molecular Weight | 474.99 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | (3R,4S)-4-[4-[(E)-3-(2-aminoanilino)-3-oxoprop-1-enyl]phenyl]-N-(3-chlorophenyl)-1-methylpyrrolidine-3-carboxamide |
| SMILES | CN1C[C@H](C(=O)Nc2cccc(Cl)c2)[C@@H](c2ccc(/C=C/C(=O)Nc3ccccc3N)cc2)C1 |
| InChI | InChI=1S/C27H27ClN4O2/c1-32-16-22(23(17-32)27(34)30-21-6-4-5-20(28)15-21)19-12-9-18(10-13-19)11-14-26(33)31-25-8-3-2-7-24(25)29/h2-15,22-23H,16-17,29H2,1H3,(H,30,34)(H,31,33)/b14-11+/t22-,23+/m1/s1 |
| InChIKey | JWDILCWILLHYQF-ZNRZVBFGSA-N |
| XLogP | 4.86 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.99 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|