C27H27FN4O2 — CID 91327102
(3R)-2-[4-[3-(2-aminoanilino)-3-oxoprop-1-enyl]phenyl]-N-(4-fluorophenyl)-1-methylpyrrolidine-3-carboxamide (PubChem CID 91327102) has the molecular formula C27H27FN4O2 and a molecular weight of 458.54 g/mol. Its IUPAC name is (3R)-2-[4-[3-(2-aminoanilino)-3-oxoprop-1-enyl]phenyl]-N-(4-fluorophenyl)-1-methylpyrrolidine-3-carboxamide.
| Compound Name | (3R)-2-[4-[3-(2-aminoanilino)-3-oxoprop-1-enyl]phenyl]-N-(4-fluorophenyl)-1-methylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 91327102 |
| Molecular Formula | C27H27FN4O2 |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | (3R)-2-[4-[3-(2-aminoanilino)-3-oxoprop-1-enyl]phenyl]-N-(4-fluorophenyl)-1-methylpyrrolidine-3-carboxamide |
| SMILES | CN1CC[C@@H](C(=O)Nc2ccc(F)cc2)C1c1ccc(C=CC(=O)Nc2ccccc2N)cc1 |
| InChI | InChI=1S/C27H27FN4O2/c1-32-17-16-22(27(34)30-21-13-11-20(28)12-14-21)26(32)19-9-6-18(7-10-19)8-15-25(33)31-24-5-3-2-4-23(24)29/h2-15,22,26H,16-17,29H2,1H3,(H,30,34)(H,31,33)/t22-,26?/m1/s1 |
| InChIKey | DBHFXVNPRJKYHH-FPSALIRRSA-N |
| XLogP | 4.69 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|