C22H25N2O4PS — CID 91550414
N-(2-amino-5-thiophen-2-ylphenyl)-3-[[ethoxy(ethyl)phosphoryl]oxymethyl]benzamide (PubChem CID 91550414) has the molecular formula C22H25N2O4PS and a molecular weight of 444.49 g/mol. Its IUPAC name is N-(2-amino-5-thiophen-2-ylphenyl)-3-[[ethoxy(ethyl)phosphoryl]oxymethyl]benzamide.
| Compound Name | N-(2-amino-5-thiophen-2-ylphenyl)-3-[[ethoxy(ethyl)phosphoryl]oxymethyl]benzamide |
|---|---|
| PubChem CID | 91550414 |
| Molecular Formula | C22H25N2O4PS |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | N-(2-amino-5-thiophen-2-ylphenyl)-3-[[ethoxy(ethyl)phosphoryl]oxymethyl]benzamide |
| SMILES | CCOP(=O)(CC)OCc1cccc(C(=O)Nc2cc(-c3cccs3)ccc2N)c1 |
| InChI | InChI=1S/C22H25N2O4PS/c1-3-27-29(26,4-2)28-15-16-7-5-8-18(13-16)22(25)24-20-14-17(10-11-19(20)23)21-9-6-12-30-21/h5-14H,3-4,15,23H2,1-2H3,(H,24,25) |
| InChIKey | ZAZOXDSALDZAMY-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|