C18H15NO2S2 — CID 168913883
N-(2-hydroxy-5-thiophen-2-ylphenyl)-4-methylsulfanylbenzamide (PubChem CID 168913883) has the molecular formula C18H15NO2S2 and a molecular weight of 341.46 g/mol. Its IUPAC name is N-(2-hydroxy-5-thiophen-2-ylphenyl)-4-methylsulfanylbenzamide.
| Compound Name | N-(2-hydroxy-5-thiophen-2-ylphenyl)-4-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 168913883 |
| Molecular Formula | C18H15NO2S2 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | N-(2-hydroxy-5-thiophen-2-ylphenyl)-4-methylsulfanylbenzamide |
| SMILES | CSc1ccc(C(=O)Nc2cc(-c3cccs3)ccc2O)cc1 |
| InChI | InChI=1S/C18H15NO2S2/c1-22-14-7-4-12(5-8-14)18(21)19-15-11-13(6-9-16(15)20)17-3-2-10-23-17/h2-11,20H,1H3,(H,19,21) |
| InChIKey | NUNUQLMOJPMAFC-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|