C26H22N2O6 — CID 108766487
4-[[2-(2,6-diethylphenyl)-1,3-dioxoisoindole-5-carbonyl]amino]-3-hydroxybenzoic acid (PubChem CID 108766487) has the molecular formula C26H22N2O6 and a molecular weight of 458.47 g/mol. Its IUPAC name is 4-[[2-(2,6-diethylphenyl)-1,3-dioxoisoindole-5-carbonyl]amino]-3-hydroxybenzoic acid.
| Compound Name | 4-[[2-(2,6-diethylphenyl)-1,3-dioxoisoindole-5-carbonyl]amino]-3-hydroxybenzoic acid |
|---|---|
| PubChem CID | 108766487 |
| Molecular Formula | C26H22N2O6 |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | 4-[[2-(2,6-diethylphenyl)-1,3-dioxoisoindole-5-carbonyl]amino]-3-hydroxybenzoic acid |
| SMILES | CCc1cccc(CC)c1N1C(=O)c2ccc(C(=O)Nc3ccc(C(=O)O)cc3O)cc2C1=O |
| InChI | InChI=1S/C26H22N2O6/c1-3-14-6-5-7-15(4-2)22(14)28-24(31)18-10-8-16(12-19(18)25(28)32)23(30)27-20-11-9-17(26(33)34)13-21(20)29/h5-13,29H,3-4H2,1-2H3,(H,27,30)(H,33,34) |
| InChIKey | YMYDYCBPJIKSHD-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|