C23H18ClNO3 — CID 4110956
[2-(4-chlorophenyl)-2-oxoethyl] 4-(1,3-dihydroisoindol-2-yl)benzoate (PubChem CID 4110956) has the molecular formula C23H18ClNO3 and a molecular weight of 391.85 g/mol. Its IUPAC name is [2-(4-chlorophenyl)-2-oxoethyl] 4-(1,3-dihydroisoindol-2-yl)benzoate.
| Compound Name | [2-(4-chlorophenyl)-2-oxoethyl] 4-(1,3-dihydroisoindol-2-yl)benzoate |
|---|---|
| PubChem CID | 4110956 |
| Molecular Formula | C23H18ClNO3 |
| Molecular Weight | 391.85 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | [2-(4-chlorophenyl)-2-oxoethyl] 4-(1,3-dihydroisoindol-2-yl)benzoate |
| SMILES | O=C(COC(=O)c1ccc(N2Cc3ccccc3C2)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H18ClNO3/c24-20-9-5-16(6-10-20)22(26)15-28-23(27)17-7-11-21(12-8-17)25-13-18-3-1-2-4-19(18)14-25/h1-12H,13-15H2 |
| InChIKey | JEORYZFRJOAWPK-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.85 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |