C25H21NO7 — CID 170224794
2-hydroxybutyl 2-[3,4-bis(prop-2-ynoxy)phenyl]-1,3-dioxoisoindole-5-carboxylate (PubChem CID 170224794) has the molecular formula C25H21NO7 and a molecular weight of 447.44 g/mol. Its IUPAC name is 2-hydroxybutyl 2-[3,4-bis(prop-2-ynoxy)phenyl]-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | 2-hydroxybutyl 2-[3,4-bis(prop-2-ynoxy)phenyl]-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 170224794 |
| Molecular Formula | C25H21NO7 |
| Molecular Weight | 447.44 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | 2-hydroxybutyl 2-[3,4-bis(prop-2-ynoxy)phenyl]-1,3-dioxoisoindole-5-carboxylate |
| SMILES | C#CCOc1ccc(N2C(=O)c3ccc(C(=O)OCC(O)CC)cc3C2=O)cc1OCC#C |
| InChI | InChI=1S/C25H21NO7/c1-4-11-31-21-10-8-17(14-22(21)32-12-5-2)26-23(28)19-9-7-16(13-20(19)24(26)29)25(30)33-15-18(27)6-3/h1-2,7-10,13-14,18,27H,6,11-12,15H2,3H3 |
| InChIKey | ZKBXWZYGOMROIS-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.44 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|