C20H19NO7 — CID 170224640
2-hydroxybutyl 2-(4-hydroxy-3-methoxyphenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 170224640) has the molecular formula C20H19NO7 and a molecular weight of 385.37 g/mol. Its IUPAC name is 2-hydroxybutyl 2-(4-hydroxy-3-methoxyphenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | 2-hydroxybutyl 2-(4-hydroxy-3-methoxyphenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 170224640 |
| Molecular Formula | C20H19NO7 |
| Molecular Weight | 385.37 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 2-hydroxybutyl 2-(4-hydroxy-3-methoxyphenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CCC(O)COC(=O)c1ccc2c(c1)C(=O)N(c1ccc(O)c(OC)c1)C2=O |
| InChI | InChI=1S/C20H19NO7/c1-3-13(22)10-28-20(26)11-4-6-14-15(8-11)19(25)21(18(14)24)12-5-7-16(23)17(9-12)27-2/h4-9,13,22-23H,3,10H2,1-2H3 |
| InChIKey | OLGUQWGEYOFEHC-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.37 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|