C29H38N2O6 — CID 163877255
5-[5-[3-[2-(3-ethyl-3-methyloxiran-2-yl)ethyl]-3-methyloxiran-2-yl]-3-methylpentyl]-1,3,10-trihydroxy-11H-benzo[b][1,4]benzodiazepin-6-one (PubChem CID 163877255) has the molecular formula C29H38N2O6 and a molecular weight of 510.63 g/mol. Its IUPAC name is 5-[5-[3-[2-(3-ethyl-3-methyloxiran-2-yl)ethyl]-3-methyloxiran-2-yl]-3-methylpentyl]-1,3,10-trihydroxy-11H-benzo[b][1,4]benzodiazepin-6-one.
| Compound Name | 5-[5-[3-[2-(3-ethyl-3-methyloxiran-2-yl)ethyl]-3-methyloxiran-2-yl]-3-methylpentyl]-1,3,10-trihydroxy-11H-benzo[b][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 163877255 |
| Molecular Formula | C29H38N2O6 |
| Molecular Weight | 510.63 g/mol |
| Exact Mass | 510.27 |
| IUPAC Name | 5-[5-[3-[2-(3-ethyl-3-methyloxiran-2-yl)ethyl]-3-methyloxiran-2-yl]-3-methylpentyl]-1,3,10-trihydroxy-11H-benzo[b][1,4]benzodiazepin-6-one |
| SMILES | CCC1(C)OC1CCC1(C)OC1CCC(C)CCN1C(=O)c2cccc(O)c2Nc2c(O)cc(O)cc21 |
| InChI | InChI=1S/C29H38N2O6/c1-5-28(3)24(36-28)11-13-29(4)23(37-29)10-9-17(2)12-14-31-20-15-18(32)16-22(34)26(20)30-25-19(27(31)35)7-6-8-21(25)33/h6-8,15-17,23-24,30,32-34H,5,9-14H2,1-4H3 |
| InChIKey | PPYYXKKDFNDJHS-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 118.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.63 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|