C28H38N2O6 — CID 143873544
1,3,10-trihydroxy-5-[3-methyl-5-[3-methyl-3-[2-[(2-methylpropan-2-yl)oxy]ethyl]oxiran-2-yl]pentyl]-11H-benzo[b][1,4]benzodiazepin-6-one (PubChem CID 143873544) has the molecular formula C28H38N2O6 and a molecular weight of 498.62 g/mol. Its IUPAC name is 1,3,10-trihydroxy-5-[3-methyl-5-[3-methyl-3-[2-[(2-methylpropan-2-yl)oxy]ethyl]oxiran-2-yl]pentyl]-11H-benzo[b][1,4]benzodiazepin-6-one.
| Compound Name | 1,3,10-trihydroxy-5-[3-methyl-5-[3-methyl-3-[2-[(2-methylpropan-2-yl)oxy]ethyl]oxiran-2-yl]pentyl]-11H-benzo[b][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 143873544 |
| Molecular Formula | C28H38N2O6 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.27 |
| IUPAC Name | 1,3,10-trihydroxy-5-[3-methyl-5-[3-methyl-3-[2-[(2-methylpropan-2-yl)oxy]ethyl]oxiran-2-yl]pentyl]-11H-benzo[b][1,4]benzodiazepin-6-one |
| SMILES | CC(CCC1OC1(C)CCOC(C)(C)C)CCN1C(=O)c2cccc(O)c2Nc2c(O)cc(O)cc21 |
| InChI | InChI=1S/C28H38N2O6/c1-17(9-10-23-28(5,36-23)12-14-35-27(2,3)4)11-13-30-20-15-18(31)16-22(33)25(20)29-24-19(26(30)34)7-6-8-21(24)32/h6-8,15-17,23,29,31-33H,9-14H2,1-5H3 |
| InChIKey | UHXBFKMDOOCXOA-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 114.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|