C24H19NO2 — CID 70596495
2-[3-(2-phenylphenyl)but-2-enyl]isoindole-1,3-dione (PubChem CID 70596495) has the molecular formula C24H19NO2 and a molecular weight of 353.42 g/mol. Its IUPAC name is 2-[3-(2-phenylphenyl)but-2-enyl]isoindole-1,3-dione.
| Compound Name | 2-[3-(2-phenylphenyl)but-2-enyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 70596495 |
| Molecular Formula | C24H19NO2 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 2-[3-(2-phenylphenyl)but-2-enyl]isoindole-1,3-dione |
| SMILES | CC(=CCN1C(=O)c2ccccc2C1=O)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C24H19NO2/c1-17(19-11-5-6-12-20(19)18-9-3-2-4-10-18)15-16-25-23(26)21-13-7-8-14-22(21)24(25)27/h2-15H,16H2,1H3 |
| InChIKey | QBGSIWLUONQKMU-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|