About 2-[(2Z)-2-chloro-2-piperazin-2-ylideneethyl]isoindole-1,3-dione;pyridine
2-[(2Z)-2-chloro-2-piperazin-2-ylideneethyl]isoindole-1,3-dione;pyridine (PubChem CID 174548084) has the molecular formula C19H19ClN4O2
and a molecular weight of 370.84 g/mol. Its IUPAC name is 2-[(2Z)-2-chloro-2-piperazin-2-ylideneethyl]isoindole-1,3-dione;pyridine.
Molecular Properties
| Compound Name | 2-[(2Z)-2-chloro-2-piperazin-2-ylideneethyl]isoindole-1,3-dione;pyridine |
| PubChem CID | 174548084 |
| Molecular Formula | C19H19ClN4O2 |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 2-[(2Z)-2-chloro-2-piperazin-2-ylideneethyl]isoindole-1,3-dione;pyridine |
| SMILES | O=C1c2ccccc2C(=O)N1C/C(Cl)=C1\CNCCN1.c1ccncc1 |
| InChI | InChI=1S/C14H14ClN3O2.C5H5N/c15-11(12-7-16-5-6-17-12)8-18-13(19)9-3-1-2-4-10(9)14(18)20;1-2-4-6-5-3-1/h1-4,16-17H,5-8H2;1-5H/b12-11-; |
| InChIKey | QETAKZXFDQRELA-AFEZEDKISA-N |
| XLogP | 2.01 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2Z)-2-chloro-2-piperazin-2-ylideneethyl]isoindole-1,3-dione;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2Z)-2-chloro-2-piperazin-2-ylideneethyl]isoindole-1,3-dione;pyridine?
The IUPAC name of 2-[(2Z)-2-chloro-2-piperazin-2-ylideneethyl]isoindole-1,3-dione;pyridine (CID 174548084) is 2-[(2Z)-2-chloro-2-piperazin-2-ylideneethyl]isoindole-1,3-dione;pyridine.
What is the SMILES notation for 2-[(2Z)-2-chloro-2-piperazin-2-ylideneethyl]isoindole-1,3-dione;pyridine?
The canonical SMILES for 2-[(2Z)-2-chloro-2-piperazin-2-ylideneethyl]isoindole-1,3-dione;pyridine is O=C1c2ccccc2C(=O)N1C/C(Cl)=C1\CNCCN1.c1ccncc1.
What is the InChIKey of 2-[(2Z)-2-chloro-2-piperazin-2-ylideneethyl]isoindole-1,3-dione;pyridine?
The InChIKey is QETAKZXFDQRELA-AFEZEDKISA-N. The full InChI is InChI=1S/C14H14ClN3O2.C5H5N/c15-11(12-7-16-5-6-17-12)8-18-13(19)9-3-1-2-4-10(9)14(18)20;1-2-4-6-5-3-1/h1-4,16-17H,5-8H2;1-5H/b12-11-;.
What are the key properties of 2-[(2Z)-2-chloro-2-piperazin-2-ylideneethyl]isoindole-1,3-dione;pyridine?
2-[(2Z)-2-chloro-2-piperazin-2-ylideneethyl]isoindole-1,3-dione;pyridine has a molecular weight of 370.84 g/mol, XLogP of 2.01, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2Z)-2-chloro-2-piperazin-2-ylideneethyl]isoindole-1,3-dione;pyridine is sourced from PubChem (CID 174548084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).