C24H36N6O3Si — CID 177493047
1-pyridin-2-yl-N-(pyridin-2-ylmethyl)-N-[[1-(3-triethoxysilylpropyl)triazol-4-yl]methyl]methanamine (PubChem CID 177493047) has the molecular formula C24H36N6O3Si and a molecular weight of 484.68 g/mol. Its IUPAC name is 1-pyridin-2-yl-N-(pyridin-2-ylmethyl)-N-[[1-(3-triethoxysilylpropyl)triazol-4-yl]methyl]methanamine.
| Compound Name | 1-pyridin-2-yl-N-(pyridin-2-ylmethyl)-N-[[1-(3-triethoxysilylpropyl)triazol-4-yl]methyl]methanamine |
|---|---|
| PubChem CID | 177493047 |
| Molecular Formula | C24H36N6O3Si |
| Molecular Weight | 484.68 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | 1-pyridin-2-yl-N-(pyridin-2-ylmethyl)-N-[[1-(3-triethoxysilylpropyl)triazol-4-yl]methyl]methanamine |
| SMILES | CCO[Si](CCCn1cc(CN(Cc2ccccn2)Cc2ccccn2)nn1)(OCC)OCC |
| InChI | InChI=1S/C24H36N6O3Si/c1-4-31-34(32-5-2,33-6-3)17-11-16-30-21-24(27-28-30)20-29(18-22-12-7-9-14-25-22)19-23-13-8-10-15-26-23/h7-10,12-15,21H,4-6,11,16-20H2,1-3H3 |
| InChIKey | WZQHGEKWYKGRBC-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 87.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.68 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|