C28H44N4O4Si — CID 102237214
1-cyclopenta-2,4-dien-1-yl-N-[[4-[4-[1-(3-triethoxysilylpropyl)triazol-4-yl]butoxy]phenyl]methyl]methanamine (PubChem CID 102237214) has the molecular formula C28H44N4O4Si and a molecular weight of 528.77 g/mol. Its IUPAC name is 1-cyclopenta-2,4-dien-1-yl-N-[[4-[4-[1-(3-triethoxysilylpropyl)triazol-4-yl]butoxy]phenyl]methyl]methanamine.
| Compound Name | 1-cyclopenta-2,4-dien-1-yl-N-[[4-[4-[1-(3-triethoxysilylpropyl)triazol-4-yl]butoxy]phenyl]methyl]methanamine |
|---|---|
| PubChem CID | 102237214 |
| Molecular Formula | C28H44N4O4Si |
| Molecular Weight | 528.77 g/mol |
| Exact Mass | 528.31 |
| IUPAC Name | 1-cyclopenta-2,4-dien-1-yl-N-[[4-[4-[1-(3-triethoxysilylpropyl)triazol-4-yl]butoxy]phenyl]methyl]methanamine |
| SMILES | CCO[Si](CCCn1cc(CCCCOc2ccc(CNCC3C=CC=C3)cc2)nn1)(OCC)OCC |
| InChI | InChI=1S/C28H44N4O4Si/c1-4-34-37(35-5-2,36-6-3)21-11-19-32-24-27(30-31-32)14-9-10-20-33-28-17-15-26(16-18-28)23-29-22-25-12-7-8-13-25/h7-8,12-13,15-18,24-25,29H,4-6,9-11,14,19-23H2,1-3H3 |
| InChIKey | ARLKKOYGMGABKW-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 79.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.77 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|