C29H39N9O5 — CID 155551017
methyl (2R)-2-[[(2S)-6-acetamido-2-[[2-[4-[[bis(pyridin-2-ylmethyl)amino]methyl]triazol-1-yl]acetyl]amino]hexanoyl]amino]propanoate (PubChem CID 155551017) has the molecular formula C29H39N9O5 and a molecular weight of 593.69 g/mol. Its IUPAC name is methyl (2R)-2-[[(2S)-6-acetamido-2-[[2-[4-[[bis(pyridin-2-ylmethyl)amino]methyl]triazol-1-yl]acetyl]amino]hexanoyl]amino]propanoate.
| Compound Name | methyl (2R)-2-[[(2S)-6-acetamido-2-[[2-[4-[[bis(pyridin-2-ylmethyl)amino]methyl]triazol-1-yl]acetyl]amino]hexanoyl]amino]propanoate |
|---|---|
| PubChem CID | 155551017 |
| Molecular Formula | C29H39N9O5 |
| Molecular Weight | 593.69 g/mol |
| Exact Mass | 593.31 |
| IUPAC Name | methyl (2R)-2-[[(2S)-6-acetamido-2-[[2-[4-[[bis(pyridin-2-ylmethyl)amino]methyl]triazol-1-yl]acetyl]amino]hexanoyl]amino]propanoate |
| SMILES | COC(=O)[C@@H](C)NC(=O)[C@H](CCCCNC(C)=O)NC(=O)Cn1cc(CN(Cc2ccccn2)Cc2ccccn2)nn1 |
| InChI | InChI=1S/C29H39N9O5/c1-21(29(42)43-3)33-28(41)26(12-6-9-13-30-22(2)39)34-27(40)20-38-19-25(35-36-38)18-37(16-23-10-4-7-14-31-23)17-24-11-5-8-15-32-24/h4-5,7-8,10-11,14-15,19,21,26H,6,9,12-13,16-18,20H2,1-3H3,(H,30,39)(H,33,41)(H,34,40)/t21-,26+/m1/s1 |
| InChIKey | LYFNBWQTRGJGMW-RLWLMLJZSA-N |
| XLogP | 0.74 |
| TPSA | 173.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.69 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|