C25H30N8O4 — CID 102480657
methyl (2S)-2,6-bis[[2-(4-cyclopenta-2,4-dien-1-yltriazol-1-yl)acetyl]amino]hexanoate (PubChem CID 102480657) has the molecular formula C25H30N8O4 and a molecular weight of 506.57 g/mol. Its IUPAC name is methyl (2S)-2,6-bis[[2-(4-cyclopenta-2,4-dien-1-yltriazol-1-yl)acetyl]amino]hexanoate.
| Compound Name | methyl (2S)-2,6-bis[[2-(4-cyclopenta-2,4-dien-1-yltriazol-1-yl)acetyl]amino]hexanoate |
|---|---|
| PubChem CID | 102480657 |
| Molecular Formula | C25H30N8O4 |
| Molecular Weight | 506.57 g/mol |
| Exact Mass | 506.24 |
| IUPAC Name | methyl (2S)-2,6-bis[[2-(4-cyclopenta-2,4-dien-1-yltriazol-1-yl)acetyl]amino]hexanoate |
| SMILES | COC(=O)[C@H](CCCCNC(=O)Cn1cc(C2C=CC=C2)nn1)NC(=O)Cn1cc(C2C=CC=C2)nn1 |
| InChI | InChI=1S/C25H30N8O4/c1-37-25(36)20(27-24(35)17-33-15-22(29-31-33)19-10-4-5-11-19)12-6-7-13-26-23(34)16-32-14-21(28-30-32)18-8-2-3-9-18/h2-5,8-11,14-15,18-20H,6-7,12-13,16-17H2,1H3,(H,26,34)(H,27,35)/t20-/m0/s1 |
| InChIKey | XONXEAZFKRAKOZ-FQEVSTJZSA-N |
| XLogP | 0.93 |
| TPSA | 145.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.57 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|