C34H35BrNO2P — CID 142458602
2-[8-[bromo(triphenyl)-λ5-phosphanyl]octyl]isoindole-1,3-dione (PubChem CID 142458602) has the molecular formula C34H35BrNO2P and a molecular weight of 600.54 g/mol. Its IUPAC name is 2-[8-[bromo(triphenyl)-λ5-phosphanyl]octyl]isoindole-1,3-dione.
| Compound Name | 2-[8-[bromo(triphenyl)-λ5-phosphanyl]octyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 142458602 |
| Molecular Formula | C34H35BrNO2P |
| Molecular Weight | 600.54 g/mol |
| Exact Mass | 599.16 |
| IUPAC Name | 2-[8-[bromo(triphenyl)-λ5-phosphanyl]octyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCCCCCCCP(Br)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H35BrNO2P/c35-39(28-18-8-5-9-19-28,29-20-10-6-11-21-29,30-22-12-7-13-23-30)27-17-4-2-1-3-16-26-36-33(37)31-24-14-15-25-32(31)34(36)38/h5-15,18-25H,1-4,16-17,26-27H2 |
| InChIKey | TVSORIXHOOMYMK-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.54 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|