C16H18N4O2 — CID 162717385
2-[6-(2H-triazol-4-yl)hexyl]isoindole-1,3-dione (PubChem CID 162717385) has the molecular formula C16H18N4O2 and a molecular weight of 298.35 g/mol. Its IUPAC name is 2-[6-(2H-triazol-4-yl)hexyl]isoindole-1,3-dione.
| Compound Name | 2-[6-(2H-triazol-4-yl)hexyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 162717385 |
| Molecular Formula | C16H18N4O2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 2-[6-(2H-triazol-4-yl)hexyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCCCCCc1cn[nH]n1 |
| InChI | InChI=1S/C16H18N4O2/c21-15-13-8-4-5-9-14(13)16(22)20(15)10-6-2-1-3-7-12-11-17-19-18-12/h4-5,8-9,11H,1-3,6-7,10H2,(H,17,18,19) |
| InChIKey | CFHJRQUYPZFLTG-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|