About 2-[[4-(1,3-dioxoisoindol-2-yl)cyclohexyl]amino]acetaldehyde
2-[[4-(1,3-dioxoisoindol-2-yl)cyclohexyl]amino]acetaldehyde (PubChem CID 174532424) has the molecular formula C16H18N2O3
and a molecular weight of 286.33 g/mol. Its IUPAC name is 2-[[4-(1,3-dioxoisoindol-2-yl)cyclohexyl]amino]acetaldehyde.
Molecular Properties
| Compound Name | 2-[[4-(1,3-dioxoisoindol-2-yl)cyclohexyl]amino]acetaldehyde |
| PubChem CID | 174532424 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 2-[[4-(1,3-dioxoisoindol-2-yl)cyclohexyl]amino]acetaldehyde |
| SMILES | O=CCNC1CCC(N2C(=O)c3ccccc3C2=O)CC1 |
| InChI | InChI=1S/C16H18N2O3/c19-10-9-17-11-5-7-12(8-6-11)18-15(20)13-3-1-2-4-14(13)16(18)21/h1-4,10-12,17H,5-9H2 |
| InChIKey | MKIKOOJPUGVEFH-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-[[4-(1,3-dioxoisoindol-2-yl)cyclohexyl]amino]acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4-(1,3-dioxoisoindol-2-yl)cyclohexyl]amino]acetaldehyde?
The IUPAC name of 2-[[4-(1,3-dioxoisoindol-2-yl)cyclohexyl]amino]acetaldehyde (CID 174532424) is 2-[[4-(1,3-dioxoisoindol-2-yl)cyclohexyl]amino]acetaldehyde.
What is the SMILES notation for 2-[[4-(1,3-dioxoisoindol-2-yl)cyclohexyl]amino]acetaldehyde?
The canonical SMILES for 2-[[4-(1,3-dioxoisoindol-2-yl)cyclohexyl]amino]acetaldehyde is O=CCNC1CCC(N2C(=O)c3ccccc3C2=O)CC1.
What is the InChIKey of 2-[[4-(1,3-dioxoisoindol-2-yl)cyclohexyl]amino]acetaldehyde?
The InChIKey is MKIKOOJPUGVEFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O3/c19-10-9-17-11-5-7-12(8-6-11)18-15(20)13-3-1-2-4-14(13)16(18)21/h1-4,10-12,17H,5-9H2.
What are the key properties of 2-[[4-(1,3-dioxoisoindol-2-yl)cyclohexyl]amino]acetaldehyde?
2-[[4-(1,3-dioxoisoindol-2-yl)cyclohexyl]amino]acetaldehyde has a molecular weight of 286.33 g/mol, XLogP of 1.38, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4-(1,3-dioxoisoindol-2-yl)cyclohexyl]amino]acetaldehyde is sourced from PubChem (CID 174532424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).