C23H24N2O4 — CID 122037836
(2R)-2-[[4-(1,3-dioxoisoindol-2-yl)cyclohexyl]amino]-3-phenylpropanoic acid (PubChem CID 122037836) has the molecular formula C23H24N2O4 and a molecular weight of 392.45 g/mol. Its IUPAC name is (2R)-2-[[4-(1,3-dioxoisoindol-2-yl)cyclohexyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2R)-2-[[4-(1,3-dioxoisoindol-2-yl)cyclohexyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 122037836 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | (2R)-2-[[4-(1,3-dioxoisoindol-2-yl)cyclohexyl]amino]-3-phenylpropanoic acid |
| SMILES | O=C(O)[C@@H](Cc1ccccc1)NC1CCC(N2C(=O)c3ccccc3C2=O)CC1 |
| InChI | InChI=1S/C23H24N2O4/c26-21-18-8-4-5-9-19(18)22(27)25(21)17-12-10-16(11-13-17)24-20(23(28)29)14-15-6-2-1-3-7-15/h1-9,16-17,20,24H,10-14H2,(H,28,29)/t16?,17?,20-/m1/s1 |
| InChIKey | CCAPOOBEDOCXBF-LBXVMSDZSA-N |
| XLogP | 2.88 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|