C16H18N4O4 — CID 155445767
3-amino-2-[[1,3-dioxo-2-(2-oxopiperidin-3-yl)isoindol-4-yl]amino]propanal (PubChem CID 155445767) has the molecular formula C16H18N4O4 and a molecular weight of 330.34 g/mol. Its IUPAC name is 3-amino-2-[[1,3-dioxo-2-(2-oxopiperidin-3-yl)isoindol-4-yl]amino]propanal.
| Compound Name | 3-amino-2-[[1,3-dioxo-2-(2-oxopiperidin-3-yl)isoindol-4-yl]amino]propanal |
|---|---|
| PubChem CID | 155445767 |
| Molecular Formula | C16H18N4O4 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 3-amino-2-[[1,3-dioxo-2-(2-oxopiperidin-3-yl)isoindol-4-yl]amino]propanal |
| SMILES | NCC(C=O)Nc1cccc2c1C(=O)N(C1CCCNC1=O)C2=O |
| InChI | InChI=1S/C16H18N4O4/c17-7-9(8-21)19-11-4-1-3-10-13(11)16(24)20(15(10)23)12-5-2-6-18-14(12)22/h1,3-4,8-9,12,19H,2,5-7,17H2,(H,18,22) |
| InChIKey | XKWCSKFFPBRTAN-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|