C24H27BrN2O6S2 — CID 158095999
1-bromo-2-ethylsulfanylethane;2-(2-ethylsulfanylethoxy)isoindole-1,3-dione;2-hydroxyisoindole-1,3-dione (PubChem CID 158095999) has the molecular formula C24H27BrN2O6S2 and a molecular weight of 583.53 g/mol. Its IUPAC name is 1-bromo-2-ethylsulfanylethane;2-(2-ethylsulfanylethoxy)isoindole-1,3-dione;2-hydroxyisoindole-1,3-dione.
| Compound Name | 1-bromo-2-ethylsulfanylethane;2-(2-ethylsulfanylethoxy)isoindole-1,3-dione;2-hydroxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 158095999 |
| Molecular Formula | C24H27BrN2O6S2 |
| Molecular Weight | 583.53 g/mol |
| Exact Mass | 582.05 |
| IUPAC Name | 1-bromo-2-ethylsulfanylethane;2-(2-ethylsulfanylethoxy)isoindole-1,3-dione;2-hydroxyisoindole-1,3-dione |
| SMILES | CCSCCBr.CCSCCON1C(=O)c2ccccc2C1=O.O=C1c2ccccc2C(=O)N1O |
| InChI | InChI=1S/C12H13NO3S.C8H5NO3.C4H9BrS/c1-2-17-8-7-16-13-11(14)9-5-3-4-6-10(9)12(13)15;10-7-5-3-1-2-4-6(5)8(11)9(7)12;1-2-6-4-3-5/h3-6H,2,7-8H2,1H3;1-4,12H;2-4H2,1H3 |
| InChIKey | FORBIOAGQAUKAN-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.53 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|