C38H38N4O4 — CID 143238310
11-[2-[3-[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethylamino]propyl-methylamino]ethyl]-11-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,13,15-heptaene-10,12-dione;ethane (PubChem CID 143238310) has the molecular formula C38H38N4O4 and a molecular weight of 614.75 g/mol. Its IUPAC name is 11-[2-[3-[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethylamino]propyl-methylamino]ethyl]-11-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,13,15-heptaene-10,12-dione;ethane.
| Compound Name | 11-[2-[3-[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethylamino]propyl-methylamino]ethyl]-11-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,13,15-heptaene-10,12-dione;ethane |
|---|---|
| PubChem CID | 143238310 |
| Molecular Formula | C38H38N4O4 |
| Molecular Weight | 614.75 g/mol |
| Exact Mass | 614.29 |
| IUPAC Name | 11-[2-[3-[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethylamino]propyl-methylamino]ethyl]-11-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,13,15-heptaene-10,12-dione;ethane |
| SMILES | CC.CN(CCCNCCN1C(=O)c2cccc3cccc(c23)C1=O)CCN1C(=O)c2cccc3c2c(cc2ccccc23)C1=O |
| InChI | InChI=1S/C36H32N4O4.C2H6/c1-38(18-7-16-37-17-19-39-33(41)27-13-4-9-23-10-5-14-28(31(23)27)34(39)42)20-21-40-35(43)29-15-6-12-26-25-11-3-2-8-24(25)22-30(32(26)29)36(40)44;1-2/h2-6,8-15,22,37H,7,16-21H2,1H3;1-2H3 |
| InChIKey | GFIHYPGTNFPSPR-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.75 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|