C11H11N3O3 — CID 101125437
N-[3-(1,3-dioxoisoindol-2-yl)propyl]nitrous amide (PubChem CID 101125437) has the molecular formula C11H11N3O3 and a molecular weight of 233.23 g/mol. Its IUPAC name is N-[3-(1,3-dioxoisoindol-2-yl)propyl]nitrous amide.
| Compound Name | N-[3-(1,3-dioxoisoindol-2-yl)propyl]nitrous amide |
|---|---|
| PubChem CID | 101125437 |
| Molecular Formula | C11H11N3O3 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | N-[3-(1,3-dioxoisoindol-2-yl)propyl]nitrous amide |
| SMILES | O=NNCCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C11H11N3O3/c15-10-8-4-1-2-5-9(8)11(16)14(10)7-3-6-12-13-17/h1-2,4-5H,3,6-7H2,(H,12,17) |
| InChIKey | PDEYLBYWYNYXMX-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|