C17H25F5N4O2 — CID 109494981
2-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-1-ethyl-3-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]guanidine (PubChem CID 109494981) has the molecular formula C17H25F5N4O2 and a molecular weight of 412.40 g/mol. Its IUPAC name is 2-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-1-ethyl-3-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]guanidine.
| Compound Name | 2-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-1-ethyl-3-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]guanidine |
|---|---|
| PubChem CID | 109494981 |
| Molecular Formula | C17H25F5N4O2 |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 2-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]-1-ethyl-3-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]guanidine |
| SMILES | CCN/C(=N\CC(O)c1ccc(OC(F)F)cc1)NCCN(C)CC(F)(F)F |
| InChI | InChI=1S/C17H25F5N4O2/c1-3-23-16(24-8-9-26(2)11-17(20,21)22)25-10-14(27)12-4-6-13(7-5-12)28-15(18)19/h4-7,14-15,27H,3,8-11H2,1-2H3,(H2,23,24,25) |
| InChIKey | YDYANBUGWGFLEP-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|